Fatty alcohols
eMolecules 106-69-4 | 1,2,6-Hexanetriol | Oakwood Chemical | MFCD00002976 | 134.175 | C6H14O3 | 0.000 | OCCCCC(O)CO | 10g | 537707160
1,2,6-Hexanetriol | Oakwood Chemical | 106-69-4 | MFCD00002976 | 134.175 | C6H14O3 | 0.000 | OCCCCC(O)CO | 10g | 537707160
[C@@H](O)CC(=O)C=O | 10mg | 562458896](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502153112.JPG-250.jpg)
eMolecules 4084-27-9 | 3-Deoxy-D-glucosone | Apollo Scientific | MFCD01723101 | 162.141 | C6H10O5 | 95.000 | OC[C@@H](O)[C@@H](O)CC(=O)C=O | 10mg | 562458896
3-Deoxy-D-glucosone | Apollo Scientific | 4084-27-9 | MFCD01723101 | 162.141 | C6H10O5 | 95.000 | OC[C@@H](O)[C@@H](O)CC(=O)C=O | 10mg | 562458896
Medchemexpress LLC 1-dodecanol | 112-53-8 | MFCD00004753 | 98.2% | 186.33 g/mol | C12H26O | 50mg
1-Dodecanol (Standard) is the analytical standard of 1-Dodecanol This product is intended for research and analytical applications 1-Dodecanol is an endogenous metabolite
eMolecules 3208-25-1 | 7-Phenyl-1-heptanol | Combi-Blocks, Inc. | MFCD00037315 | 192.302 | C13H20O | 97.000 | OCCCCCCCc1ccccc1 | 1g | 603146304
7-Phenyl-1-heptanol | Combi-Blocks, Inc. | 3208-25-1 | MFCD00037315 | 192.302 | C13H20O | 97.000 | OCCCCCCCc1ccccc1 | 1g | 603146304
eMolecules 41453-56-9 | CIS-2-NONEN-1-OL | AstaTech | MFCD00063210 | 142.242 | C9H18O | 95.000 | CCCCCC\C=C/CO | 0.25g | 722710270
CIS-2-NONEN-1-OL | AstaTech | 41453-56-9 | MFCD00063210 | 142.242 | C9H18O | 95.000 | CCCCCC\C=C/CO | 0.25g | 722710270
Sigma Aldrich Fine Chemicals Biosciences 1-Octanol natural, >=98%, FCC | 111-87-5 | MFCD00002988 | 1KG
1-Octanol natural, >=98%, FCC | Purity: >=98% | Mol Wt: 130.23 | 111-87-5 | MFCD00002988 | 1KG
Sigma Aldrich Fine Chemicals Biosciences 1-Octanol anhydrous, >=99% | 111-87-5 | MFCD00002988 | 1L
1-Octanol anhydrous, >=99% | Purity: >=99% | Mol Wt: 130.23 | 111-87-5 | MFCD00002988 | 1L
Sigma Aldrich Fine Chemicals Biosciences Retinol synthetic, >=95% (HPLC), crystalline | 68-26-8 | MFCD00001552 | 1G
Retinol synthetic, >=95% (HPLC), crystalline | Purity: >=95% (HPLC) | Mol Wt: 286.45 | 68-26-8 | MFCD00001552 | 1G
Chemscene ChemScene | Undec-10-en-1-amine,97%(stabilized with MEHQ) | 5G | CS-0068719 | 97%(stabilized with MEHQ) | 62595-52-2| MFCD04974014 | 169.31
ChemScene | Undec-10-en-1-amine,97%(stabilized with MEHQ) | 5G | CS-0068719 | 97%(stabilized with MEHQ) | 62595-52-2| MFCD04974014 | 169.31